1 | D-phenylalanine |
2 | H-D-Phe-OH |
3 | (2R)-2-amino-3-phenylpropanoic acid |
4 | Phenylalanine D-form |
5 | Sabiden |
D-phenylalanine is the D-enantiomer of phenylalanine. It is a phenylalanine and a D-alpha-amino acid. It is a conjugate base of a D-phenylalaninium. It is a conjugate acid of a D-phenylalaninate. It is an enantiomer of a L-phenylalanine. It is a tautomer of a D-phenylalanine zwitterion.
Molecular Formula | C9H11NO2 |
---|---|
Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |
Isomeric SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)N |
Molecular Weight | 165.1900 |
InChIKey | COLNVLDHVKWLRT-MRVPVSSYSA-N |
InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1 |
XLogP | -1.5000 |
ExactMass | 165.0790 |
MonoisotopicMass | 165.0790 |
TPSA | 63.3000 |
Complexity | 153.0000 |
Charge | 0.0000 |
HBondDonorCount | 2 |
HBondAcceptorCount | 3 |
RotatableBondCount | 3 |
HeavyAtomCount | 12 |
IsotopeAtomCount | 0 |
AtomStereoCount | 1 |
DefinedAtomStereoCount | 1 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 20304 |
PatentFamilyCount | 6283 |
LiteratureCount | 1693 |