1 | glycine |
2 | 2-Aminoacetic acid |
3 | aminoacetic acid |
4 | Glycocoll |
5 | Aminoethanoic acid |
Glycine is the simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. It has a role as a nutraceutical, a hepatoprotective agent, an EC 2.1.2.1 (glycine hydroxymethyltransferase) inhibitor, a NMDA receptor agonist, a micronutrient, a fundamental metabolite and a neurotransmitter. It is an alpha-amino acid, a serine family amino acid and a proteinogenic amino acid. It is a conjugate base of a glycinium. It is a conjugate acid of a glycinate. It is a tautomer of a glycine zwitterion.
Molecular Formula | C2H5NO2 |
---|---|
Canonical SMILES | C(C(=O)O)N |
Isomeric SMILES | C(C(=O)O)N |
Molecular Weight | 75.0700 |
InChIKey | DHMQDGOQFOQNFH-UHFFFAOYSA-N |
InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
XLogP | -3.2000 |
ExactMass | 75.0320 |
MonoisotopicMass | 75.0320 |
TPSA | 63.3000 |
Complexity | 42.0000 |
Charge | 0.0000 |
HBondDonorCount | 2 |
HBondAcceptorCount | 3 |
RotatableBondCount | 1 |
HeavyAtomCount | 5 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 88671 |
PatentFamilyCount | 39119 |
LiteratureCount | 124182 |