1 | Phenazopyridine hydrochloride |
2 | Phenazopyridine HCl |
3 | Pyridium |
4 | Urodine |
5 | Mallophene |
Phenazopyridine hydrochloride is a hydrochloride obtained by combining phenazopyridine with one equivalent of hydrochloric acid. A local anesthetic that has topical analgesic effect on mucosa lining of the urinary tract. Its use is limited by problems with toxicity (primarily blood disorders) and potential carcinogenicity. It has a role as a carcinogenic agent, a local anaesthetic and a non-narcotic analgesic. It contains a phenazopyridine(1+).
Molecular Formula | C11H12ClN5 |
---|---|
Canonical SMILES | C1=CC=C(C=C1)N=NC2=C(N=C(C=C2)N)N.Cl |
Isomeric SMILES | C1=CC=C(C=C1)N=NC2=C(N=C(C=C2)N)N.Cl |
Molecular Weight | 249.7000 |
InChIKey | QQBPIHBUCMDKFG-UHFFFAOYSA-N |
InChI | InChI=1S/C11H11N5.ClH/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;/h1-7H,(H4,12,13,14);1H |
XLogP | 0.0000 |
ExactMass | 249.0781 |
MonoisotopicMass | 249.0781 |
TPSA | 89.6000 |
Complexity | 237.0000 |
Charge | 0.0000 |
HBondDonorCount | 3 |
HBondAcceptorCount | 5 |
RotatableBondCount | 2 |
HeavyAtomCount | 17 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 2 |
PatentCount | 7530 |
PatentFamilyCount | 3235 |
LiteratureCount | 765 |