Sodium Oxalate
CAS: 62-76-0
| 1 | Sodium oxalate |
| 2 | Disodium oxalate |
| 3 | Natriumoxalat |
| 4 | Ethanedioic acid, disodium salt |
| 5 | Oxalic acid disodium salt |
Sodium oxalate is an organic sodium salt consisting of sodium and oxalate ions in a 2:1 ratio. It has a role as a poison and a reducing agent. It is an oxalate salt and an organic sodium salt. It contains an oxalate(2-).
| Molecular Formula | C2Na2O4 |
|---|---|
| Canonical SMILES | C(=O)(C(=O)[O-])[O-].[Na+].[Na+] |
| Isomeric SMILES | C(=O)(C(=O)[O-])[O-].[Na+].[Na+] |
| Molecular Weight | 134.0000 |
| InChIKey | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| InChI | InChI=1S/C2H2O4.2Na/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;/q;2*+1/p-2 |
| XLogP | 0.0000 |
| ExactMass | 133.9592 |
| MonoisotopicMass | 133.9592 |
| TPSA | 80.3000 |
| Complexity | 60.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 8 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 3 |
| PatentCount | 17989 |
| PatentFamilyCount | 9787 |
| LiteratureCount | 4800 |