1 | azobenzene |
2 | Diphenyldiazene |
3 | 1,2-Diphenyldiazene |
4 | (E)-1,2-Diphenyldiazene |
5 | Diazene, diphenyl- |
Azobenzene is a molecule whose structure comprises two phenyl rings linked by a N=N double bond; the parent compound of the azobenzene class of compounds.
Molecular Formula | C12H10N2 |
---|---|
Canonical SMILES | C1=CC=C(C=C1)N=NC2=CC=CC=C2 |
Isomeric SMILES | C1=CC=C(C=C1)N=NC2=CC=CC=C2 |
Molecular Weight | 182.2200 |
InChIKey | DMLAVOWQYNRWNQ-UHFFFAOYSA-N |
InChI | InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
XLogP | 3.8000 |
ExactMass | 182.0844 |
MonoisotopicMass | 182.0844 |
TPSA | 24.7000 |
Complexity | 157.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 2 |
RotatableBondCount | 2 |
HeavyAtomCount | 14 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 37127 |
PatentFamilyCount | 15632 |
LiteratureCount | 6278 |