Ammonium oxalate
CAS: 1113-38-8
| 1 | AMMONIUM OXALATE |
| 2 | Diammonium oxalate |
| 3 | Ethanedioic acid diammonium salt |
| 4 | Ethanedioic acid, diammonium salt |
| 5 | Oxalic acid, diammonium salt |
Ammonium oxalate is an ammonium salt consisting of ammonium and oxalate ions in a 2:1 ratio. It is an ammonium salt and an oxalate salt. It contains an oxalate(2-).
| Molecular Formula | C2H8N2O4 |
|---|---|
| Canonical SMILES | C(=O)(C(=O)[O-])[O-].[NH4+].[NH4+] |
| Isomeric SMILES | C(=O)(C(=O)[O-])[O-].[NH4+].[NH4+] |
| Molecular Weight | 124.1000 |
| InChIKey | VBIXEXWLHSRNKB-UHFFFAOYSA-N |
| InChI | InChI=1S/C2H2O4.2H3N/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);2*1H3 |
| XLogP | 0.0000 |
| ExactMass | 124.0484 |
| MonoisotopicMass | 124.0484 |
| TPSA | 82.3000 |
| Complexity | 60.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 8 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 3 |
| PatentCount | 15708 |
| PatentFamilyCount | 8351 |
| LiteratureCount | 6891 |