1 | DIPHENYL ETHER |
2 | Diphenyl oxide |
3 | Phenyl ether |
4 | Phenoxybenzene |
5 | Oxydibenzene |
Diphenyl ether is an aromatic ether in which the oxygen is attached to two phenyl substituents. It has been found in muscat grapes and vanilla. It has a role as a plant metabolite.
Molecular Formula | C12H10O |
---|---|
Canonical SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
Isomeric SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
Molecular Weight | 170.2100 |
InChIKey | USIUVYZYUHIAEV-UHFFFAOYSA-N |
InChI | InChI=1S/C12H10O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
XLogP | 4.2000 |
ExactMass | 170.0732 |
MonoisotopicMass | 170.0732 |
TPSA | 9.2000 |
Complexity | 116.0000 |
Charge | 0.0000 |
HBondDonorCount | 0 |
HBondAcceptorCount | 1 |
RotatableBondCount | 2 |
HeavyAtomCount | 13 |
IsotopeAtomCount | 0 |
AtomStereoCount | 0 |
DefinedAtomStereoCount | 0 |
UndefinedAtomStereoCount | 0 |
BondStereoCount | 0 |
DefinedBondStereoCount | 0 |
UndefinedBondStereoCount | 0 |
CovalentUnitCount | 1 |
PatentCount | 131270 |
PatentFamilyCount | 51969 |
LiteratureCount | 4752 |