Triphenyl phosphate
CAS: 115-86-6
| 1 | TRIPHENYL PHOSPHATE |
| 2 | Triphenylphosphate |
| 3 | Phosphoric acid, triphenyl ester |
| 4 | Disflamoll TP |
| 5 | Celluflex TPP |
Triphenyl phosphate is an aryl phosphate resulting from the formal condensation of phosphoric acid with 3 mol eq. of phenol. It has a role as a flame retardant and a plasticiser. It is functionally related to a phenol.
| Molecular Formula | C18H15O4P |
|---|---|
| Canonical SMILES | C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| Isomeric SMILES | C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| Molecular Weight | 326.3000 |
| InChIKey | XZZNDPSIHUTMOC-UHFFFAOYSA-N |
| InChI | InChI=1S/C18H15O4P/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H |
| XLogP | 4.6000 |
| ExactMass | 326.0708 |
| MonoisotopicMass | 326.0708 |
| TPSA | 44.8000 |
| Complexity | 325.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 6 |
| HeavyAtomCount | 23 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 113667 |
| PatentFamilyCount | 51169 |
| LiteratureCount | 1585 |